C11H14F3N3O2 — CID 119399141
2-methyl-3-(methylamino)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide (PubChem CID 119399141) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide.
| Compound Name | 2-methyl-3-(methylamino)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 119399141 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide |
| SMILES | CNCC(C)C(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C11H14F3N3O2/c1-6(4-15-2)9(18)17-8-3-7(11(12,13)14)5-16-10(8)19/h3,5-6,15H,4H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | LDPFXPNZRFCXKP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |