C15H19F3N2O2 — CID 138578414
4-ethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]hept-6-enamide (PubChem CID 138578414) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-ethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]hept-6-enamide.
| Compound Name | 4-ethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]hept-6-enamide |
|---|---|
| PubChem CID | 138578414 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-ethyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]hept-6-enamide |
| SMILES | C=CCC(CC)CCC(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C15H19F3N2O2/c1-3-5-10(4-2)6-7-13(21)20-12-8-11(15(16,17)18)9-19-14(12)22/h3,8-10H,1,4-7H2,2H3,(H,19,22)(H,20,21) |
| InChIKey | NECWCZDNMYYBPM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|