C18H18F3N3O4 — CID 55794854
4-methoxy-N-[4-oxo-4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]amino]butyl]benzamide (PubChem CID 55794854) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is 4-methoxy-N-[4-oxo-4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]amino]butyl]benzamide.
| Compound Name | 4-methoxy-N-[4-oxo-4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 55794854 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-methoxy-N-[4-oxo-4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]amino]butyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCCC(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H18F3N3O4/c1-28-13-6-4-11(5-7-13)16(26)22-8-2-3-15(25)24-14-9-12(18(19,20)21)10-23-17(14)27/h4-7,9-10H,2-3,8H2,1H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | XJGFIUVGVVGELG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|