C19H17F3N4O2S — CID 26725781
N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]thiophene-3-carboxamide (PubChem CID 26725781) has the molecular formula C19H17F3N4O2S and a molecular weight of 422.43 g/mol. Its IUPAC name is N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]thiophene-3-carboxamide.
| Compound Name | N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 26725781 |
| Molecular Formula | C19H17F3N4O2S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)Nc1cc(C(F)(F)F)ccc1-n1cccn1 |
| InChI | InChI=1S/C19H17F3N4O2S/c20-19(21,22)14-4-5-16(26-9-2-8-24-26)15(11-14)25-17(27)3-1-7-23-18(28)13-6-10-29-12-13/h2,4-6,8-12H,1,3,7H2,(H,23,28)(H,25,27) |
| InChIKey | VJCUVRVVKIWPOU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|