C19H17F3N4O3 — CID 26725768
N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]furan-2-carboxamide (PubChem CID 26725768) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]furan-2-carboxamide.
| Compound Name | N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26725768 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[4-oxo-4-[2-pyrazol-1-yl-5-(trifluoromethyl)anilino]butyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)Nc1cc(C(F)(F)F)ccc1-n1cccn1 |
| InChI | InChI=1S/C19H17F3N4O3/c20-19(21,22)13-6-7-15(26-10-3-9-24-26)14(12-13)25-17(27)5-1-8-23-18(28)16-4-2-11-29-16/h2-4,6-7,9-12H,1,5,8H2,(H,23,28)(H,25,27) |
| InChIKey | OYCTVYMAQQFIRT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|