C12H12F3N5O2S — CID 36579974
N-[4-oxo-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]butyl]thiophene-3-carboxamide (PubChem CID 36579974) has the molecular formula C12H12F3N5O2S and a molecular weight of 347.32 g/mol. Its IUPAC name is N-[4-oxo-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]butyl]thiophene-3-carboxamide.
| Compound Name | N-[4-oxo-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 36579974 |
| Molecular Formula | C12H12F3N5O2S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[4-oxo-4-[[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]butyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)Nc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H12F3N5O2S/c13-12(14,15)10-18-11(20-19-10)17-8(21)2-1-4-16-9(22)7-3-5-23-6-7/h3,5-6H,1-2,4H2,(H,16,22)(H2,17,18,19,20,21) |
| InChIKey | ZKBGTYYRHRTZEN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|