C13H16N4O2S2 — CID 30275509
N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 30275509) has the molecular formula C13H16N4O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30275509 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | CCc1nnc(NC(=O)CCCNC(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C13H16N4O2S2/c1-2-11-16-17-13(21-11)15-10(18)4-3-6-14-12(19)9-5-7-20-8-9/h5,7-8H,2-4,6H2,1H3,(H,14,19)(H,15,17,18) |
| InChIKey | VETKANQFOIDLSF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|