C19H28N4O2S — CID 9398182
N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]adamantane-1-carboxamide (PubChem CID 9398182) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9398182 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutyl]adamantane-1-carboxamide |
| SMILES | CCc1nnc(NC(=O)CCCNC(=O)C23CC4CC(CC(C4)C2)C3)s1 |
| InChI | InChI=1S/C19H28N4O2S/c1-2-16-22-23-18(26-16)21-15(24)4-3-5-20-17(25)19-9-12-6-13(10-19)8-14(7-12)11-19/h12-14H,2-11H2,1H3,(H,20,25)(H,21,23,24) |
| InChIKey | UWULSUFBZSLHGB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|