C15H20BrN3OS — CID 7718666
(5S,7R)-3-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide (PubChem CID 7718666) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is (5S,7R)-3-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7718666 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (5S,7R)-3-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide |
| SMILES | CCc1nnc(NC(=O)C23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)s1 |
| InChI | InChI=1S/C15H20BrN3OS/c1-2-11-18-19-13(21-11)17-12(20)14-4-9-3-10(5-14)7-15(16,6-9)8-14/h9-10H,2-8H2,1H3,(H,17,19,20)/t9-,10+,14?,15? |
| InChIKey | LOSXSMIHZKKKIQ-SEGBCRLWSA-N |
| XLogP | 3.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|