C17H18F2N2O4S2 — CID 75400886
N-[4-[3-(difluoromethyl)-4-methylsulfonylanilino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 75400886) has the molecular formula C17H18F2N2O4S2 and a molecular weight of 416.47 g/mol. Its IUPAC name is N-[4-[3-(difluoromethyl)-4-methylsulfonylanilino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[3-(difluoromethyl)-4-methylsulfonylanilino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 75400886 |
| Molecular Formula | C17H18F2N2O4S2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-[4-[3-(difluoromethyl)-4-methylsulfonylanilino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)CCCNC(=O)c2ccsc2)cc1C(F)F |
| InChI | InChI=1S/C17H18F2N2O4S2/c1-27(24,25)14-5-4-12(9-13(14)16(18)19)21-15(22)3-2-7-20-17(23)11-6-8-26-10-11/h4-6,8-10,16H,2-3,7H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | ZRXBLZMUZSZQQJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|