C14H8F6N2O3 — CID 55488373
N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 55488373) has the molecular formula C14H8F6N2O3 and a molecular weight of 366.22 g/mol. Its IUPAC name is N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 55488373 |
| Molecular Formula | C14H8F6N2O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)c[nH]c1=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H8F6N2O3/c15-13(16,17)8-5-10(12(24)21-6-8)22-11(23)7-1-3-9(4-2-7)25-14(18,19)20/h1-6H,(H,21,24)(H,22,23) |
| InChIKey | XGQKCNIPDWWDEX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |