C12H8F3N3O3 — CID 108797111
N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide (PubChem CID 108797111) has the molecular formula C12H8F3N3O3 and a molecular weight of 299.21 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108797111 |
| Molecular Formula | C12H8F3N3O3 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1c[nH]c(=O)[nH]c1=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H8F3N3O3/c13-12(14,15)7-3-1-6(2-4-7)9(19)17-8-5-16-11(21)18-10(8)20/h1-5H,(H,17,19)(H2,16,18,20,21) |
| InChIKey | ZWMTWSPGCHQKAW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |