C17H13N3O3 — CID 810233
N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-phenylbenzamide (PubChem CID 810233) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-phenylbenzamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 810233 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-4-phenylbenzamide |
| SMILES | O=C(Nc1c[nH]c(=O)[nH]c1=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H13N3O3/c21-15(19-14-10-18-17(23)20-16(14)22)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10H,(H,19,21)(H2,18,20,22,23) |
| InChIKey | TZXSXUXCXGSSBY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |