C14H14N4O5 — CID 42580706
N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-[(2R)-2-hydroxy-2-phenylethyl]oxamide (PubChem CID 42580706) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-[(2R)-2-hydroxy-2-phenylethyl]oxamide.
| Compound Name | N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-[(2R)-2-hydroxy-2-phenylethyl]oxamide |
|---|---|
| PubChem CID | 42580706 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-[(2R)-2-hydroxy-2-phenylethyl]oxamide |
| SMILES | O=C(NC[C@H](O)c1ccccc1)C(=O)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H14N4O5/c19-10(8-4-2-1-3-5-8)7-15-12(21)13(22)17-9-6-16-14(23)18-11(9)20/h1-6,10,19H,7H2,(H,15,21)(H,17,22)(H2,16,18,20,23)/t10-/m0/s1 |
| InChIKey | QWYDTXRIWQJPHK-JTQLQIEISA-N |
| XLogP | -1.15 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|