C12H16F3N3O3 — CID 111431494
1-(2-hydroxypentyl)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea (PubChem CID 111431494) has the molecular formula C12H16F3N3O3 and a molecular weight of 307.27 g/mol. Its IUPAC name is 1-(2-hydroxypentyl)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea.
| Compound Name | 1-(2-hydroxypentyl)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea |
|---|---|
| PubChem CID | 111431494 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-(2-hydroxypentyl)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea |
| SMILES | CCCC(O)CNC(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C12H16F3N3O3/c1-2-3-8(19)6-17-11(21)18-9-4-7(12(13,14)15)5-16-10(9)20/h4-5,8,19H,2-3,6H2,1H3,(H,16,20)(H2,17,18,21) |
| InChIKey | VSIWVDVFZXGQNY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |