acetic acid;2-amino-4-(trifluoromethyl)phenol

C9H10F3NO3 — CID 174902727

IUPACacetic acid;2-amino-4-(trifluoromethyl)phenol
SMILESCC(=O)O.Nc1cc(C(F)(F)F)ccc1O
InChIInChI=1S/C7H6F3NO.C2H4O2/c8-7(9,10)4-1-2-6(12)5(11)3-4;1-2(3)4/h1-3,12H,11H2;1H3,(H,3,4)
InChIKeyHZYMUBXHNBLHLJ-UHFFFAOYSA-N
MW237.18 g/mol
LogP2.08
Rot. Bonds

About acetic acid;2-amino-4-(trifluoromethyl)phenol

acetic acid;2-amino-4-(trifluoromethyl)phenol (PubChem CID 174902727) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is acetic acid;2-amino-4-(trifluoromethyl)phenol.

Molecular Properties

Compound Nameacetic acid;2-amino-4-(trifluoromethyl)phenol
PubChem CID174902727
Molecular FormulaC9H10F3NO3
Molecular Weight237.18 g/mol
Exact Mass237.06
IUPAC Nameacetic acid;2-amino-4-(trifluoromethyl)phenol
SMILESCC(=O)O.Nc1cc(C(F)(F)F)ccc1O
InChIInChI=1S/C7H6F3NO.C2H4O2/c8-7(9,10)4-1-2-6(12)5(11)3-4;1-2(3)4/h1-3,12H,11H2;1H3,(H,3,4)
InChIKeyHZYMUBXHNBLHLJ-UHFFFAOYSA-N
XLogP2.08
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.18
LogP ≤ 52.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze acetic acid;2-amino-4-(trifluoromethyl)phenol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-amino-4-(trifluoromethyl)phenol?
The IUPAC name of acetic acid;2-amino-4-(trifluoromethyl)phenol (CID 174902727) is acetic acid;2-amino-4-(trifluoromethyl)phenol.
What is the SMILES notation for acetic acid;2-amino-4-(trifluoromethyl)phenol?
The canonical SMILES for acetic acid;2-amino-4-(trifluoromethyl)phenol is CC(=O)O.Nc1cc(C(F)(F)F)ccc1O.
What is the InChIKey of acetic acid;2-amino-4-(trifluoromethyl)phenol?
The InChIKey is HZYMUBXHNBLHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO.C2H4O2/c8-7(9,10)4-1-2-6(12)5(11)3-4;1-2(3)4/h1-3,12H,11H2;1H3,(H,3,4).
What are the key properties of acetic acid;2-amino-4-(trifluoromethyl)phenol?
acetic acid;2-amino-4-(trifluoromethyl)phenol has a molecular weight of 237.18 g/mol, XLogP of 2.08, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-amino-4-(trifluoromethyl)phenol is sourced from PubChem (CID 174902727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).