C9H10F3NO3 — CID 174902727
acetic acid;2-amino-4-(trifluoromethyl)phenol (PubChem CID 174902727) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is acetic acid;2-amino-4-(trifluoromethyl)phenol.
| Compound Name | acetic acid;2-amino-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 174902727 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | acetic acid;2-amino-4-(trifluoromethyl)phenol |
| SMILES | CC(=O)O.Nc1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C7H6F3NO.C2H4O2/c8-7(9,10)4-1-2-6(12)5(11)3-4;1-2(3)4/h1-3,12H,11H2;1H3,(H,3,4) |
| InChIKey | HZYMUBXHNBLHLJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|