C18H12Cl2N2O4S2 — CID 58122311
5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-2-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylic acid (PubChem CID 58122311) has the molecular formula C18H12Cl2N2O4S2 and a molecular weight of 455.34 g/mol. Its IUPAC name is 5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-2-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-2-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58122311 |
| Molecular Formula | C18H12Cl2N2O4S2 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-2-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)O)s1)c1cc(O)c(-c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C18H12Cl2N2O4S2/c1-8(21-22-17(24)13-4-5-14(27-13)18(25)26)15-7-12(23)16(28-15)9-2-3-10(19)11(20)6-9/h2-7,23H,1H3,(H,22,24)(H,25,26) |
| InChIKey | ZFUMTFBUKQYEDC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|