C18H15BrN6O2S2 — CID 76615073
N-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(2,3-dihydro-1H-tetrazol-5-yl)thiophene-2-carboxamide (PubChem CID 76615073) has the molecular formula C18H15BrN6O2S2 and a molecular weight of 491.40 g/mol. Its IUPAC name is N-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(2,3-dihydro-1H-tetrazol-5-yl)thiophene-2-carboxamide.
| Compound Name | N-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(2,3-dihydro-1H-tetrazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 76615073 |
| Molecular Formula | C18H15BrN6O2S2 |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | N-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(2,3-dihydro-1H-tetrazol-5-yl)thiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccc(C2=NNNN2)s1)c1csc(-c2ccc(Br)cc2)c1O |
| InChI | InChI=1S/C18H15BrN6O2S2/c1-9(12-8-28-16(15(12)26)10-2-4-11(19)5-3-10)20-23-18(27)14-7-6-13(29-14)17-21-24-25-22-17/h2-8,24-26H,1H3,(H,21,22)(H,23,27) |
| InChIKey | NNCDEJOOJYJABX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|