C15H21ClN2 — CID 10778059
1-[5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]ethanimine (PubChem CID 10778059) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 1-[5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]ethanimine.
| Compound Name | 1-[5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]ethanimine |
|---|---|
| PubChem CID | 10778059 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-[5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]ethanimine |
| SMILES | [H]/N=C(\C)c1cc(Cl)ccc1N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C15H21ClN2/c1-10-6-11(2)9-18(8-10)15-5-4-13(16)7-14(15)12(3)17/h4-5,7,10-11,17H,6,8-9H2,1-3H3/b17-12+/t10-,11+ |
| InChIKey | WQDWRHUVKGLPCI-GEWUBVFTSA-N |
| XLogP | 4.21 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|