C23H27ClN2O3 — CID 12919525
4-[2-[[5-chloro-2-(3,5-dimethylpiperidin-1-yl)benzoyl]amino]ethyl]benzoic acid (PubChem CID 12919525) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 4-[2-[[5-chloro-2-(3,5-dimethylpiperidin-1-yl)benzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[5-chloro-2-(3,5-dimethylpiperidin-1-yl)benzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 12919525 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[2-[[5-chloro-2-(3,5-dimethylpiperidin-1-yl)benzoyl]amino]ethyl]benzoic acid |
| SMILES | CC1CC(C)CN(c2ccc(Cl)cc2C(=O)NCCc2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-15-11-16(2)14-26(13-15)21-8-7-19(24)12-20(21)22(27)25-10-9-17-3-5-18(6-4-17)23(28)29/h3-8,12,15-16H,9-11,13-14H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | VYVITXCBCOLLKT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |