C27H33ClN2O3 — CID 12784569
ethyl 4-[2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chlorobenzoyl]amino]ethyl]benzoate (PubChem CID 12784569) has the molecular formula C27H33ClN2O3 and a molecular weight of 469.03 g/mol. Its IUPAC name is ethyl 4-[2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chlorobenzoyl]amino]ethyl]benzoate.
| Compound Name | ethyl 4-[2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chlorobenzoyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 12784569 |
| Molecular Formula | C27H33ClN2O3 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | ethyl 4-[2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chlorobenzoyl]amino]ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCNC(=O)c2cc(Cl)ccc2N2CCC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C27H33ClN2O3/c1-2-33-27(32)21-9-7-19(8-10-21)13-15-29-26(31)24-17-23(28)11-12-25(24)30-16-14-20-5-3-4-6-22(20)18-30/h7-12,17,20,22H,2-6,13-16,18H2,1H3,(H,29,31) |
| InChIKey | SLMNAHDBUCTAFX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |