C24H32Cl2N2O — CID 70532427
2-(azonan-1-yl)-5-chloro-N-[2-(4-methylphenyl)ethyl]benzamide;hydrochloride (PubChem CID 70532427) has the molecular formula C24H32Cl2N2O and a molecular weight of 435.44 g/mol. Its IUPAC name is 2-(azonan-1-yl)-5-chloro-N-[2-(4-methylphenyl)ethyl]benzamide;hydrochloride.
| Compound Name | 2-(azonan-1-yl)-5-chloro-N-[2-(4-methylphenyl)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 70532427 |
| Molecular Formula | C24H32Cl2N2O |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-(azonan-1-yl)-5-chloro-N-[2-(4-methylphenyl)ethyl]benzamide;hydrochloride |
| SMILES | Cc1ccc(CCNC(=O)c2cc(Cl)ccc2N2CCCCCCCC2)cc1.Cl |
| InChI | InChI=1S/C24H31ClN2O.ClH/c1-19-8-10-20(11-9-19)14-15-26-24(28)22-18-21(25)12-13-23(22)27-16-6-4-2-3-5-7-17-27;/h8-13,18H,2-7,14-17H2,1H3,(H,26,28);1H |
| InChIKey | VJNUDJRTFIGAKP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |