C23H26ClN3O5 — CID 70535745
4-[2-[[5-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)benzoyl]amino]ethyl]benzoic acid (PubChem CID 70535745) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is 4-[2-[[5-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)benzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[5-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)benzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70535745 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 4-[2-[[5-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)benzoyl]amino]ethyl]benzoic acid |
| SMILES | CCOC(=O)N1CCN(c2ccc(Cl)cc2C(=O)NCCc2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C23H26ClN3O5/c1-2-32-23(31)27-13-11-26(12-14-27)20-8-7-18(24)15-19(20)21(28)25-10-9-16-3-5-17(6-4-16)22(29)30/h3-8,15H,2,9-14H2,1H3,(H,25,28)(H,29,30) |
| InChIKey | YWUUWIPJBFEWLJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |