C26H33ClN2O4 — CID 10838212
methyl 4-[2-[[2-(azonan-1-yl)-5-chlorobenzoyl]amino]ethyl]-2-methoxybenzoate (PubChem CID 10838212) has the molecular formula C26H33ClN2O4 and a molecular weight of 473.01 g/mol. Its IUPAC name is methyl 4-[2-[[2-(azonan-1-yl)-5-chlorobenzoyl]amino]ethyl]-2-methoxybenzoate.
| Compound Name | methyl 4-[2-[[2-(azonan-1-yl)-5-chlorobenzoyl]amino]ethyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 10838212 |
| Molecular Formula | C26H33ClN2O4 |
| Molecular Weight | 473.01 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | methyl 4-[2-[[2-(azonan-1-yl)-5-chlorobenzoyl]amino]ethyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(CCNC(=O)c2cc(Cl)ccc2N2CCCCCCCC2)cc1OC |
| InChI | InChI=1S/C26H33ClN2O4/c1-32-24-17-19(9-11-21(24)26(31)33-2)13-14-28-25(30)22-18-20(27)10-12-23(22)29-15-7-5-3-4-6-8-16-29/h9-12,17-18H,3-8,13-16H2,1-2H3,(H,28,30) |
| InChIKey | IJPLNKSFUIUTPA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.01 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |