C20H23ClN3O5S- — CID 56996988
4-[4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-(sulfinatoamino)phenyl]morpholine (PubChem CID 56996988) has the molecular formula C20H23ClN3O5S- and a molecular weight of 452.94 g/mol. Its IUPAC name is 4-[4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-(sulfinatoamino)phenyl]morpholine.
| Compound Name | 4-[4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-(sulfinatoamino)phenyl]morpholine |
|---|---|
| PubChem CID | 56996988 |
| Molecular Formula | C20H23ClN3O5S- |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 4-[4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-2-(sulfinatoamino)phenyl]morpholine |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccc(N2CCOCC2)c(NS(=O)[O-])c1 |
| InChI | InChI=1S/C20H24ClN3O5S/c1-28-19-5-3-15(21)13-16(19)20(25)22-7-6-14-2-4-18(17(12-14)23-30(26)27)24-8-10-29-11-9-24/h2-5,12-13,23H,6-11H2,1H3,(H,22,25)(H,26,27)/p-1 |
| InChIKey | LVXAQYGUAWZFPE-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|