C24H27BrN2O3 — CID 13078643
4-[2-[[2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-5-bromobenzoyl]amino]ethyl]benzoic acid (PubChem CID 13078643) has the molecular formula C24H27BrN2O3 and a molecular weight of 471.40 g/mol. Its IUPAC name is 4-[2-[[2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-5-bromobenzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-5-bromobenzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 13078643 |
| Molecular Formula | C24H27BrN2O3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 4-[2-[[2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-5-bromobenzoyl]amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNC(=O)c2cc(Br)ccc2N2CC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C24H27BrN2O3/c25-20-9-10-22(27-14-18-3-1-2-4-19(18)15-27)21(13-20)23(28)26-12-11-16-5-7-17(8-6-16)24(29)30/h5-10,13,18-19H,1-4,11-12,14-15H2,(H,26,28)(H,29,30) |
| InChIKey | ITDYLAKLEQQZFG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |