C26H26BrNO4 — CID 25271162
4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoic acid (PubChem CID 25271162) has the molecular formula C26H26BrNO4 and a molecular weight of 496.40 g/mol. Its IUPAC name is 4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 25271162 |
| Molecular Formula | C26H26BrNO4 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoic acid |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NCCc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H26BrNO4/c1-2-3-16-32-24-13-12-22(27)17-23(24)25(29)28-15-14-18-4-6-19(7-5-18)20-8-10-21(11-9-20)26(30)31/h4-13,17H,2-3,14-16H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | CNUSMHMPVXPRIM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|