C30H31ClN2O5 — CID 25267333
2-[4-[4-[2-[(2-butoxy-5-chlorobenzoyl)amino]ethyl]phenyl]-2-cyanophenoxy]-2-methylpropanoic acid (PubChem CID 25267333) has the molecular formula C30H31ClN2O5 and a molecular weight of 535.04 g/mol. Its IUPAC name is 2-[4-[4-[2-[(2-butoxy-5-chlorobenzoyl)amino]ethyl]phenyl]-2-cyanophenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-[2-[(2-butoxy-5-chlorobenzoyl)amino]ethyl]phenyl]-2-cyanophenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 25267333 |
| Molecular Formula | C30H31ClN2O5 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-[4-[4-[2-[(2-butoxy-5-chlorobenzoyl)amino]ethyl]phenyl]-2-cyanophenoxy]-2-methylpropanoic acid |
| SMILES | CCCCOc1ccc(Cl)cc1C(=O)NCCc1ccc(-c2ccc(OC(C)(C)C(=O)O)c(C#N)c2)cc1 |
| InChI | InChI=1S/C30H31ClN2O5/c1-4-5-16-37-27-13-11-24(31)18-25(27)28(34)33-15-14-20-6-8-21(9-7-20)22-10-12-26(23(17-22)19-32)38-30(2,3)29(35)36/h6-13,17-18H,4-5,14-16H2,1-3H3,(H,33,34)(H,35,36) |
| InChIKey | PJQXKLNIHSOKCN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|