C28H27ClN2O4 — CID 86669063
butyl 2-[4-[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenoxy]-3-cyanophenyl]acetate (PubChem CID 86669063) has the molecular formula C28H27ClN2O4 and a molecular weight of 490.99 g/mol. Its IUPAC name is butyl 2-[4-[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenoxy]-3-cyanophenyl]acetate.
| Compound Name | butyl 2-[4-[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenoxy]-3-cyanophenyl]acetate |
|---|---|
| PubChem CID | 86669063 |
| Molecular Formula | C28H27ClN2O4 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | butyl 2-[4-[4-[2-(4-chlorophenyl)ethylcarbamoyl]phenoxy]-3-cyanophenyl]acetate |
| SMILES | CCCCOC(=O)Cc1ccc(Oc2ccc(C(=O)NCCc3ccc(Cl)cc3)cc2)c(C#N)c1 |
| InChI | InChI=1S/C28H27ClN2O4/c1-2-3-16-34-27(32)18-21-6-13-26(23(17-21)19-30)35-25-11-7-22(8-12-25)28(33)31-15-14-20-4-9-24(29)10-5-20/h4-13,17H,2-3,14-16,18H2,1H3,(H,31,33) |
| InChIKey | JTVHHYCLNBLSEQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|