C32H40BrNO4 — CID 143794503
tert-butyl 4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoate;ethane (PubChem CID 143794503) has the molecular formula C32H40BrNO4 and a molecular weight of 582.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoate;ethane.
| Compound Name | tert-butyl 4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoate;ethane |
|---|---|
| PubChem CID | 143794503 |
| Molecular Formula | C32H40BrNO4 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | tert-butyl 4-[4-[2-[(5-bromo-2-butoxybenzoyl)amino]ethyl]phenyl]benzoate;ethane |
| SMILES | CC.CCCCOc1ccc(Br)cc1C(=O)NCCc1ccc(-c2ccc(C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H34BrNO4.C2H6/c1-5-6-19-35-27-16-15-25(31)20-26(27)28(33)32-18-17-21-7-9-22(10-8-21)23-11-13-24(14-12-23)29(34)36-30(2,3)4;1-2/h7-16,20H,5-6,17-19H2,1-4H3,(H,32,33);1-2H3 |
| InChIKey | YNBGGOAMPLUGFU-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|