C32H30Br2N2O4 — CID 17046885
5-bromo-N-[2-[[5-bromo-2-(2-phenylethoxy)benzoyl]amino]ethyl]-2-(2-phenylethoxy)benzamide (PubChem CID 17046885) has the molecular formula C32H30Br2N2O4 and a molecular weight of 666.41 g/mol. Its IUPAC name is 5-bromo-N-[2-[[5-bromo-2-(2-phenylethoxy)benzoyl]amino]ethyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | 5-bromo-N-[2-[[5-bromo-2-(2-phenylethoxy)benzoyl]amino]ethyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17046885 |
| Molecular Formula | C32H30Br2N2O4 |
| Molecular Weight | 666.41 g/mol |
| Exact Mass | 664.06 |
| IUPAC Name | 5-bromo-N-[2-[[5-bromo-2-(2-phenylethoxy)benzoyl]amino]ethyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NCCNC(=O)c1cc(Br)ccc1OCCc1ccccc1)c1cc(Br)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C32H30Br2N2O4/c33-25-11-13-29(39-19-15-23-7-3-1-4-8-23)27(21-25)31(37)35-17-18-36-32(38)28-22-26(34)12-14-30(28)40-20-16-24-9-5-2-6-10-24/h1-14,21-22H,15-20H2,(H,35,37)(H,36,38) |
| InChIKey | BVFPPNGDYGFOSO-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.41 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|