C21H25ClN2O5 — CID 70592948
(2S)-2-amino-3-[4-[2-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]ethyl]phenyl]propanoic acid (PubChem CID 70592948) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[2-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]ethyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[2-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]ethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70592948 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2S)-2-amino-3-[4-[2-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]ethyl]phenyl]propanoic acid |
| SMILES | COCCOc1ccc(Cl)cc1C(=O)NCCc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C21H25ClN2O5/c1-28-10-11-29-19-7-6-16(22)13-17(19)20(25)24-9-8-14-2-4-15(5-3-14)12-18(23)21(26)27/h2-7,13,18H,8-12,23H2,1H3,(H,24,25)(H,26,27)/t18-/m0/s1 |
| InChIKey | XHTVGHIDRGERAW-SFHVURJKSA-N |
| XLogP | 2.29 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|