C15H20ClNO5 — CID 120689709
4-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]-3-methylbutanoic acid (PubChem CID 120689709) has the molecular formula C15H20ClNO5 and a molecular weight of 329.78 g/mol. Its IUPAC name is 4-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | 4-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120689709 |
| Molecular Formula | C15H20ClNO5 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-[[5-chloro-2-(2-methoxyethoxy)benzoyl]amino]-3-methylbutanoic acid |
| SMILES | COCCOc1ccc(Cl)cc1C(=O)NCC(C)CC(=O)O |
| InChI | InChI=1S/C15H20ClNO5/c1-10(7-14(18)19)9-17-15(20)12-8-11(16)3-4-13(12)22-6-5-21-2/h3-4,8,10H,5-7,9H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | CMVUQCUMSFMHJU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|