About 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate
1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate (PubChem CID 69018130) has the molecular formula C13H17ClO5
and a molecular weight of 288.73 g/mol. Its IUPAC name is 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate.
Molecular Properties
| Compound Name | 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate |
| PubChem CID | 69018130 |
| Molecular Formula | C13H17ClO5 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate |
| SMILES | COCCOc1ccc(Cl)cc1C(=O)OC(C)OC |
| InChI | InChI=1S/C13H17ClO5/c1-9(17-3)19-13(15)11-8-10(14)4-5-12(11)18-7-6-16-2/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | RYVJFNXKWHCFMG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate?
The IUPAC name of 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate (CID 69018130) is 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate.
What is the SMILES notation for 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate?
The canonical SMILES for 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate is COCCOc1ccc(Cl)cc1C(=O)OC(C)OC.
What is the InChIKey of 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate?
The InChIKey is RYVJFNXKWHCFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO5/c1-9(17-3)19-13(15)11-8-10(14)4-5-12(11)18-7-6-16-2/h4-5,8-9H,6-7H2,1-3H3.
What are the key properties of 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate?
1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate has a molecular weight of 288.73 g/mol, XLogP of 2.51, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethyl 5-chloro-2-(2-methoxyethoxy)benzoate is sourced from PubChem (CID 69018130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).