C21H23BrN2O3 — CID 70588447
4-[1-[(5-bromo-2-piperidin-1-ylbenzoyl)amino]ethyl]benzoic acid (PubChem CID 70588447) has the molecular formula C21H23BrN2O3 and a molecular weight of 431.33 g/mol. Its IUPAC name is 4-[1-[(5-bromo-2-piperidin-1-ylbenzoyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[(5-bromo-2-piperidin-1-ylbenzoyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70588447 |
| Molecular Formula | C21H23BrN2O3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-[1-[(5-bromo-2-piperidin-1-ylbenzoyl)amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)c1cc(Br)ccc1N1CCCCC1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H23BrN2O3/c1-14(15-5-7-16(8-6-15)21(26)27)23-20(25)18-13-17(22)9-10-19(18)24-11-3-2-4-12-24/h5-10,13-14H,2-4,11-12H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | ATIRDBFAWMOVES-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |