C24H30N4O4 — CID 4285590
ethyl 4-[[3-(propylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate (PubChem CID 4285590) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 4-[[3-(propylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[3-(propylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 4285590 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | ethyl 4-[[3-(propylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate |
| SMILES | CCCNC(=O)c1cc(NC(=O)Nc2ccc(C(=O)OCC)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C24H30N4O4/c1-3-13-25-22(29)20-16-19(11-12-21(20)28-14-5-6-15-28)27-24(31)26-18-9-7-17(8-10-18)23(30)32-4-2/h7-12,16H,3-6,13-15H2,1-2H3,(H,25,29)(H2,26,27,31) |
| InChIKey | CZIGLYIABFXGFU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|