About butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane
butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane (PubChem CID 144767802) has the molecular formula C13H24ClN3
and a molecular weight of 257.81 g/mol. Its IUPAC name is butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane.
Molecular Properties
| Compound Name | butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane |
| PubChem CID | 144767802 |
| Molecular Formula | C13H24ClN3 |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane |
| SMILES | CC.CCCC.[H]/N=C(\C)c1cnc(Cl)cc1N |
| InChI | InChI=1S/C7H8ClN3.C4H10.C2H6/c1-4(9)5-3-11-7(8)2-6(5)10;1-3-4-2;1-2/h2-3,9H,1H3,(H2,10,11);3-4H2,1-2H3;1-2H3/b9-4+;; |
| InChIKey | PBLYJSWJISVFQC-HPJBNNNXSA-N |
| XLogP | 4.54 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane?
The IUPAC name of butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane (CID 144767802) is butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane.
What is the SMILES notation for butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane?
The canonical SMILES for butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane is CC.CCCC.[H]/N=C(\C)c1cnc(Cl)cc1N.
What is the InChIKey of butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane?
The InChIKey is PBLYJSWJISVFQC-HPJBNNNXSA-N. The full InChI is InChI=1S/C7H8ClN3.C4H10.C2H6/c1-4(9)5-3-11-7(8)2-6(5)10;1-3-4-2;1-2/h2-3,9H,1H3,(H2,10,11);3-4H2,1-2H3;1-2H3/b9-4+;;.
What are the key properties of butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane?
butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane has a molecular weight of 257.81 g/mol, XLogP of 4.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-chloro-5-ethanimidoylpyridin-4-amine;ethane is sourced from PubChem (CID 144767802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).