C18H22ClN3 — CID 167080790
2-chloro-5-(2-ethyl-5-phenylpentanimidoyl)pyridin-4-amine (PubChem CID 167080790) has the molecular formula C18H22ClN3 and a molecular weight of 315.85 g/mol. Its IUPAC name is 2-chloro-5-(2-ethyl-5-phenylpentanimidoyl)pyridin-4-amine.
| Compound Name | 2-chloro-5-(2-ethyl-5-phenylpentanimidoyl)pyridin-4-amine |
|---|---|
| PubChem CID | 167080790 |
| Molecular Formula | C18H22ClN3 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-chloro-5-(2-ethyl-5-phenylpentanimidoyl)pyridin-4-amine |
| SMILES | [H]/N=C(/c1cnc(Cl)cc1N)C(CC)CCCc1ccccc1 |
| InChI | InChI=1S/C18H22ClN3/c1-2-14(10-6-9-13-7-4-3-5-8-13)18(21)15-12-22-17(19)11-16(15)20/h3-5,7-8,11-12,14,21H,2,6,9-10H2,1H3,(H2,20,22)/b21-18+ |
| InChIKey | PFHISPZBPGNAEK-DYTRJAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|