About ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine
ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine (PubChem CID 176566491) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine.
Molecular Properties
| Compound Name | ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine |
| PubChem CID | 176566491 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine |
| SMILES | CC.CC.CN.[H]/N=C(\C)c1ccc(C)cc1OCC |
| InChI | InChI=1S/C11H15NO.2C2H6.CH5N/c1-4-13-11-7-8(2)5-6-10(11)9(3)12;3*1-2/h5-7,12H,4H2,1-3H3;2*1-2H3;2H2,1H3/b12-9+;;; |
| InChIKey | IFCAHYIYQVGFDW-MRPQEHAPSA-N |
| XLogP | 4.41 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine?
The IUPAC name of ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine (CID 176566491) is ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine.
What is the SMILES notation for ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine?
The canonical SMILES for ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine is CC.CC.CN.[H]/N=C(\C)c1ccc(C)cc1OCC.
What is the InChIKey of ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine?
The InChIKey is IFCAHYIYQVGFDW-MRPQEHAPSA-N. The full InChI is InChI=1S/C11H15NO.2C2H6.CH5N/c1-4-13-11-7-8(2)5-6-10(11)9(3)12;3*1-2/h5-7,12H,4H2,1-3H3;2*1-2H3;2H2,1H3/b12-9+;;;.
What are the key properties of ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine?
ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine has a molecular weight of 268.44 g/mol, XLogP of 4.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-ethoxy-4-methylphenyl)ethanimine;methanamine is sourced from PubChem (CID 176566491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).