C12H16OS2 — CID 72543160
1-(2-ethoxy-5-methylphenyl)prop-1-ene-1,2-dithiol (PubChem CID 72543160) has the molecular formula C12H16OS2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(2-ethoxy-5-methylphenyl)prop-1-ene-1,2-dithiol.
| Compound Name | 1-(2-ethoxy-5-methylphenyl)prop-1-ene-1,2-dithiol |
|---|---|
| PubChem CID | 72543160 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-(2-ethoxy-5-methylphenyl)prop-1-ene-1,2-dithiol |
| SMILES | CCOc1ccc(C)cc1C(S)=C(C)S |
| InChI | InChI=1S/C12H16OS2/c1-4-13-11-6-5-8(2)7-10(11)12(15)9(3)14/h5-7,14-15H,4H2,1-3H3 |
| InChIKey | DPFGWAGHNVHVKJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|