About 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene
1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene (PubChem CID 143611312) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene.
Molecular Properties
| Compound Name | 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene |
| PubChem CID | 143611312 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene |
| SMILES | CC=C(C)C.CCOc1ccc(C)cc1CC |
| InChI | InChI=1S/C11H16O.C5H10/c1-4-10-8-9(3)6-7-11(10)12-5-2;1-4-5(2)3/h6-8H,4-5H2,1-3H3;4H,1-3H3 |
| InChIKey | NSDKNNYQFBPZBJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene?
The IUPAC name of 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene (CID 143611312) is 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene.
What is the SMILES notation for 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene?
The canonical SMILES for 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene is CC=C(C)C.CCOc1ccc(C)cc1CC.
What is the InChIKey of 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene?
The InChIKey is NSDKNNYQFBPZBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C5H10/c1-4-10-8-9(3)6-7-11(10)12-5-2;1-4-5(2)3/h6-8H,4-5H2,1-3H3;4H,1-3H3.
What are the key properties of 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene?
1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene has a molecular weight of 234.38 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2-ethyl-4-methylbenzene;2-methylbut-2-ene is sourced from PubChem (CID 143611312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).