C21H26O4 — CID 129039214
methyl 2-[3-ethoxy-2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]acetate (PubChem CID 129039214) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 2-[3-ethoxy-2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-ethoxy-2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 129039214 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | methyl 2-[3-ethoxy-2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]acetate |
| SMILES | CCOc1cccc(CC(=O)OC)c1COc1ccc(C)cc1CC |
| InChI | InChI=1S/C21H26O4/c1-5-16-12-15(3)10-11-19(16)25-14-18-17(13-21(22)23-4)8-7-9-20(18)24-6-2/h7-12H,5-6,13-14H2,1-4H3 |
| InChIKey | SWSNBUKQKRFDML-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |