C9H14ClN3 — CID 115021883
6-chloro-4-N,4-N-diethylpyridine-3,4-diamine (PubChem CID 115021883) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is 6-chloro-4-N,4-N-diethylpyridine-3,4-diamine.
| Compound Name | 6-chloro-4-N,4-N-diethylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 115021883 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 6-chloro-4-N,4-N-diethylpyridine-3,4-diamine |
| SMILES | CCN(CC)c1cc(Cl)ncc1N |
| InChI | InChI=1S/C9H14ClN3/c1-3-13(4-2)8-5-9(10)12-6-7(8)11/h5-6H,3-4,11H2,1-2H3 |
| InChIKey | JKBWKVJETGASRX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|