C8H13ClN4 — CID 84669787
5-chloro-2-N,2-N-diethylpyrimidine-2,4-diamine (PubChem CID 84669787) has the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. Its IUPAC name is 5-chloro-2-N,2-N-diethylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N,2-N-diethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 84669787 |
| Molecular Formula | C8H13ClN4 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-chloro-2-N,2-N-diethylpyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ncc(Cl)c(N)n1 |
| InChI | InChI=1S/C8H13ClN4/c1-3-13(4-2)8-11-5-6(9)7(10)12-8/h5H,3-4H2,1-2H3,(H2,10,11,12) |
| InChIKey | ACTOSUDXBUVFJP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |