C15H16Cl2N4O2 — CID 48692385
5-chloro-N-(5-chloro-2-hydroxyphenyl)-2-(diethylamino)pyrimidine-4-carboxamide (PubChem CID 48692385) has the molecular formula C15H16Cl2N4O2 and a molecular weight of 355.23 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-hydroxyphenyl)-2-(diethylamino)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(5-chloro-2-hydroxyphenyl)-2-(diethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 48692385 |
| Molecular Formula | C15H16Cl2N4O2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-hydroxyphenyl)-2-(diethylamino)pyrimidine-4-carboxamide |
| SMILES | CCN(CC)c1ncc(Cl)c(C(=O)Nc2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C15H16Cl2N4O2/c1-3-21(4-2)15-18-8-10(17)13(20-15)14(23)19-11-7-9(16)5-6-12(11)22/h5-8,22H,3-4H2,1-2H3,(H,19,23) |
| InChIKey | FIDDCXUGCMTVQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|