C16H17Cl2N3O — CID 109194822
N-(2,4-dichlorophenyl)-5-(diethylamino)pyridine-2-carboxamide (PubChem CID 109194822) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-(diethylamino)pyridine-2-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-5-(diethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109194822 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-(diethylamino)pyridine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(C(=O)Nc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C16H17Cl2N3O/c1-3-21(4-2)12-6-8-15(19-10-12)16(22)20-14-7-5-11(17)9-13(14)18/h5-10H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | GWCAZLCBNZJTPN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |