C16H20Cl2N4O2 — CID 145019698
2-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethanimidoylpyrimidin-4-amine;ethane (PubChem CID 145019698) has the molecular formula C16H20Cl2N4O2 and a molecular weight of 371.27 g/mol. Its IUPAC name is 2-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethanimidoylpyrimidin-4-amine;ethane.
| Compound Name | 2-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethanimidoylpyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 145019698 |
| Molecular Formula | C16H20Cl2N4O2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethanimidoylpyrimidin-4-amine;ethane |
| SMILES | CC.[H]/N=C(\C)c1cnc(-c2c(Cl)c(OC)cc(OC)c2Cl)nc1N |
| InChI | InChI=1S/C14H14Cl2N4O2.C2H6/c1-6(17)7-5-19-14(20-13(7)18)10-11(15)8(21-2)4-9(22-3)12(10)16;1-2/h4-5,17H,1-3H3,(H2,18,19,20);1-2H3/b17-6+; |
| InChIKey | TWPSCNWHGGXXCV-ZDEOBDHWSA-N |
| XLogP | 4.46 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|