C8H7Cl3 — CID 142944405
1,4,7-trichloro-3-methylcyclohepta-1,3,5-triene (PubChem CID 142944405) has the molecular formula C8H7Cl3 and a molecular weight of 209.50 g/mol. Its IUPAC name is 1,4,7-trichloro-3-methylcyclohepta-1,3,5-triene.
| Compound Name | 1,4,7-trichloro-3-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142944405 |
| Molecular Formula | C8H7Cl3 |
| Molecular Weight | 209.50 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | 1,4,7-trichloro-3-methylcyclohepta-1,3,5-triene |
| SMILES | CC1=C(Cl)C=CC(Cl)C(Cl)=C1 |
| InChI | InChI=1S/C8H7Cl3/c1-5-4-8(11)7(10)3-2-6(5)9/h2-4,7H,1H3 |
| InChIKey | GSYSIEVGLIVRDD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|