C8H11ClO — CID 145414627
6-chloro-2,5-dimethylcyclohexa-1,3-dien-1-ol (PubChem CID 145414627) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is 6-chloro-2,5-dimethylcyclohexa-1,3-dien-1-ol.
| Compound Name | 6-chloro-2,5-dimethylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 145414627 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 6-chloro-2,5-dimethylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1=C(O)C(Cl)C(C)C=C1 |
| InChI | InChI=1S/C8H11ClO/c1-5-3-4-6(2)8(10)7(5)9/h3-5,7,10H,1-2H3 |
| InChIKey | GQTXUDSPQRYFDC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|