C10H19N — CID 144863717
ethane;2,3,6-trimethyl-2,3-dihydropyridine (PubChem CID 144863717) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is ethane;2,3,6-trimethyl-2,3-dihydropyridine.
| Compound Name | ethane;2,3,6-trimethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 144863717 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | ethane;2,3,6-trimethyl-2,3-dihydropyridine |
| SMILES | CC.CC1=NC(C)C(C)C=C1 |
| InChI | InChI=1S/C8H13N.C2H6/c1-6-4-5-7(2)9-8(6)3;1-2/h4-6,8H,1-3H3;1-2H3 |
| InChIKey | ORPKBGGKBNXUFG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |